C24H27FN4O3 — CID 53135726
1-ethyl-4-[[4-[4-(4-fluorophenyl)piperazine-1-carbonyl]phenyl]methyl]piperazine-2,3-dione (PubChem CID 53135726) has the molecular formula C24H27FN4O3 and a molecular weight of 438.50 g/mol. Its IUPAC name is 1-ethyl-4-[[4-[4-(4-fluorophenyl)piperazine-1-carbonyl]phenyl]methyl]piperazine-2,3-dione.
| Compound Name | 1-ethyl-4-[[4-[4-(4-fluorophenyl)piperazine-1-carbonyl]phenyl]methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 53135726 |
| Molecular Formula | C24H27FN4O3 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 1-ethyl-4-[[4-[4-(4-fluorophenyl)piperazine-1-carbonyl]phenyl]methyl]piperazine-2,3-dione |
| SMILES | CCN1CCN(Cc2ccc(C(=O)N3CCN(c4ccc(F)cc4)CC3)cc2)C(=O)C1=O |
| InChI | InChI=1S/C24H27FN4O3/c1-2-26-11-16-29(24(32)23(26)31)17-18-3-5-19(6-4-18)22(30)28-14-12-27(13-15-28)21-9-7-20(25)8-10-21/h3-10H,2,11-17H2,1H3 |
| InChIKey | GPNRDYKRJHVWOA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|