C21H29N5O2S — CID 53136798
N-butan-2-yl-2-[6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-4-yl]sulfanylacetamide (PubChem CID 53136798) has the molecular formula C21H29N5O2S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-butan-2-yl-2-[6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-4-yl]sulfanylacetamide.
| Compound Name | N-butan-2-yl-2-[6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-4-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 53136798 |
| Molecular Formula | C21H29N5O2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-butan-2-yl-2-[6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-4-yl]sulfanylacetamide |
| SMILES | CCC(C)NC(=O)CSc1cc(N2CCN(c3ccc(OC)cc3)CC2)ncn1 |
| InChI | InChI=1S/C21H29N5O2S/c1-4-16(2)24-20(27)14-29-21-13-19(22-15-23-21)26-11-9-25(10-12-26)17-5-7-18(28-3)8-6-17/h5-8,13,15-16H,4,9-12,14H2,1-3H3,(H,24,27) |
| InChIKey | OAIBMEZCQOQLCY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|