C21H26N4O3S — CID 53142149
ethyl 4-[[2-[4-(azepan-1-yl)pyrimidin-2-yl]sulfanylacetyl]amino]benzoate (PubChem CID 53142149) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is ethyl 4-[[2-[4-(azepan-1-yl)pyrimidin-2-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[4-(azepan-1-yl)pyrimidin-2-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 53142149 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | ethyl 4-[[2-[4-(azepan-1-yl)pyrimidin-2-yl]sulfanylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSc2nccc(N3CCCCCC3)n2)cc1 |
| InChI | InChI=1S/C21H26N4O3S/c1-2-28-20(27)16-7-9-17(10-8-16)23-19(26)15-29-21-22-12-11-18(24-21)25-13-5-3-4-6-14-25/h7-12H,2-6,13-15H2,1H3,(H,23,26) |
| InChIKey | YYELRXXKDNVULT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |