C19H24N4O5S — CID 53142997
methyl 3-[[3-(azepan-1-ylsulfonyl)-1-methylpyrazole-4-carbonyl]amino]benzoate (PubChem CID 53142997) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is methyl 3-[[3-(azepan-1-ylsulfonyl)-1-methylpyrazole-4-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[3-(azepan-1-ylsulfonyl)-1-methylpyrazole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 53142997 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | methyl 3-[[3-(azepan-1-ylsulfonyl)-1-methylpyrazole-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cn(C)nc2S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C19H24N4O5S/c1-22-13-16(17(24)20-15-9-7-8-14(12-15)19(25)28-2)18(21-22)29(26,27)23-10-5-3-4-6-11-23/h7-9,12-13H,3-6,10-11H2,1-2H3,(H,20,24) |
| InChIKey | LQHYVHYCHYOFHF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |