C17H21ClN4O3S — CID 83273764
N-(3-chlorophenyl)-1-ethyl-3-piperidin-1-ylsulfonylpyrazole-4-carboxamide (PubChem CID 83273764) has the molecular formula C17H21ClN4O3S and a molecular weight of 396.90 g/mol. Its IUPAC name is N-(3-chlorophenyl)-1-ethyl-3-piperidin-1-ylsulfonylpyrazole-4-carboxamide.
| Compound Name | N-(3-chlorophenyl)-1-ethyl-3-piperidin-1-ylsulfonylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 83273764 |
| Molecular Formula | C17H21ClN4O3S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-(3-chlorophenyl)-1-ethyl-3-piperidin-1-ylsulfonylpyrazole-4-carboxamide |
| SMILES | CCn1cc(C(=O)Nc2cccc(Cl)c2)c(S(=O)(=O)N2CCCCC2)n1 |
| InChI | InChI=1S/C17H21ClN4O3S/c1-2-21-12-15(16(23)19-14-8-6-7-13(18)11-14)17(20-21)26(24,25)22-9-4-3-5-10-22/h6-8,11-12H,2-5,9-10H2,1H3,(H,19,23) |
| InChIKey | FVIIGSHAZKFUKK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |