C19H26N4O4S — CID 53142973
1-ethyl-N-(4-methoxyphenyl)-3-(4-methylpiperidin-1-yl)sulfonylpyrazole-4-carboxamide (PubChem CID 53142973) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is 1-ethyl-N-(4-methoxyphenyl)-3-(4-methylpiperidin-1-yl)sulfonylpyrazole-4-carboxamide.
| Compound Name | 1-ethyl-N-(4-methoxyphenyl)-3-(4-methylpiperidin-1-yl)sulfonylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 53142973 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 1-ethyl-N-(4-methoxyphenyl)-3-(4-methylpiperidin-1-yl)sulfonylpyrazole-4-carboxamide |
| SMILES | CCn1cc(C(=O)Nc2ccc(OC)cc2)c(S(=O)(=O)N2CCC(C)CC2)n1 |
| InChI | InChI=1S/C19H26N4O4S/c1-4-22-13-17(18(24)20-15-5-7-16(27-3)8-6-15)19(21-22)28(25,26)23-11-9-14(2)10-12-23/h5-8,13-14H,4,9-12H2,1-3H3,(H,20,24) |
| InChIKey | OKWBDEUBOMALMO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |