C15H11FN2O2S — CID 53143182
2-(3-fluorophenyl)-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)acetamide (PubChem CID 53143182) has the molecular formula C15H11FN2O2S and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)acetamide.
| Compound Name | 2-(3-fluorophenyl)-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 53143182 |
| Molecular Formula | C15H11FN2O2S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-(3-fluorophenyl)-N-(3-thiophen-2-yl-1,2-oxazol-5-yl)acetamide |
| SMILES | O=C(Cc1cccc(F)c1)Nc1cc(-c2cccs2)no1 |
| InChI | InChI=1S/C15H11FN2O2S/c16-11-4-1-3-10(7-11)8-14(19)17-15-9-12(18-20-15)13-5-2-6-21-13/h1-7,9H,8H2,(H,17,19) |
| InChIKey | AKJIOQUPRGBOEJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |