C20H24N4O — CID 53143748
N-[2-(3-ethylimidazo[4,5-b]pyridin-2-yl)ethyl]-2-phenylbutanamide (PubChem CID 53143748) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[2-(3-ethylimidazo[4,5-b]pyridin-2-yl)ethyl]-2-phenylbutanamide.
| Compound Name | N-[2-(3-ethylimidazo[4,5-b]pyridin-2-yl)ethyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 53143748 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[2-(3-ethylimidazo[4,5-b]pyridin-2-yl)ethyl]-2-phenylbutanamide |
| SMILES | CCC(C(=O)NCCc1nc2cccnc2n1CC)c1ccccc1 |
| InChI | InChI=1S/C20H24N4O/c1-3-16(15-9-6-5-7-10-15)20(25)22-14-12-18-23-17-11-8-13-21-19(17)24(18)4-2/h5-11,13,16H,3-4,12,14H2,1-2H3,(H,22,25) |
| InChIKey | MJEUNHCANCJATI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |