C17H17FN4O — CID 71842734
N-[2-(3-ethylimidazo[4,5-b]pyridin-2-yl)ethyl]-3-fluorobenzamide (PubChem CID 71842734) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is N-[2-(3-ethylimidazo[4,5-b]pyridin-2-yl)ethyl]-3-fluorobenzamide.
| Compound Name | N-[2-(3-ethylimidazo[4,5-b]pyridin-2-yl)ethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 71842734 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-[2-(3-ethylimidazo[4,5-b]pyridin-2-yl)ethyl]-3-fluorobenzamide |
| SMILES | CCn1c(CCNC(=O)c2cccc(F)c2)nc2cccnc21 |
| InChI | InChI=1S/C17H17FN4O/c1-2-22-15(21-14-7-4-9-19-16(14)22)8-10-20-17(23)12-5-3-6-13(18)11-12/h3-7,9,11H,2,8,10H2,1H3,(H,20,23) |
| InChIKey | PZUAJZUVJZGREF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |