C17H21FN6O — CID 53143993
4-amino-N-[(2-fluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)pyrimidine-5-carboxamide (PubChem CID 53143993) has the molecular formula C17H21FN6O and a molecular weight of 344.39 g/mol. Its IUPAC name is 4-amino-N-[(2-fluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)pyrimidine-5-carboxamide.
| Compound Name | 4-amino-N-[(2-fluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 53143993 |
| Molecular Formula | C17H21FN6O |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4-amino-N-[(2-fluorophenyl)methyl]-2-(4-methylpiperazin-1-yl)pyrimidine-5-carboxamide |
| SMILES | CN1CCN(c2ncc(C(=O)NCc3ccccc3F)c(N)n2)CC1 |
| InChI | InChI=1S/C17H21FN6O/c1-23-6-8-24(9-7-23)17-21-11-13(15(19)22-17)16(25)20-10-12-4-2-3-5-14(12)18/h2-5,11H,6-10H2,1H3,(H,20,25)(H2,19,21,22) |
| InChIKey | LLVRPUYAYNNBPV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |