About 2-amino-N-[(2-fluorophenyl)methyl]-6-methylpyridine-3-carboxamide;formaldehyde
2-amino-N-[(2-fluorophenyl)methyl]-6-methylpyridine-3-carboxamide;formaldehyde (PubChem CID 158871409) has the molecular formula C15H16FN3O2
and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-amino-N-[(2-fluorophenyl)methyl]-6-methylpyridine-3-carboxamide;formaldehyde.
Molecular Properties
| Compound Name | 2-amino-N-[(2-fluorophenyl)methyl]-6-methylpyridine-3-carboxamide;formaldehyde |
| PubChem CID | 158871409 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-amino-N-[(2-fluorophenyl)methyl]-6-methylpyridine-3-carboxamide;formaldehyde |
| SMILES | C=O.Cc1ccc(C(=O)NCc2ccccc2F)c(N)n1 |
| InChI | InChI=1S/C14H14FN3O.CH2O/c1-9-6-7-11(13(16)18-9)14(19)17-8-10-4-2-3-5-12(10)15;1-2/h2-7H,8H2,1H3,(H2,16,18)(H,17,19);1H2 |
| InChIKey | JBWVHZHQAOCEKB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-N-[(2-fluorophenyl)methyl]-6-methylpyridine-3-carboxamide;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[(2-fluorophenyl)methyl]-6-methylpyridine-3-carboxamide;formaldehyde?
The IUPAC name of 2-amino-N-[(2-fluorophenyl)methyl]-6-methylpyridine-3-carboxamide;formaldehyde (CID 158871409) is 2-amino-N-[(2-fluorophenyl)methyl]-6-methylpyridine-3-carboxamide;formaldehyde.
What is the SMILES notation for 2-amino-N-[(2-fluorophenyl)methyl]-6-methylpyridine-3-carboxamide;formaldehyde?
The canonical SMILES for 2-amino-N-[(2-fluorophenyl)methyl]-6-methylpyridine-3-carboxamide;formaldehyde is C=O.Cc1ccc(C(=O)NCc2ccccc2F)c(N)n1.
What is the InChIKey of 2-amino-N-[(2-fluorophenyl)methyl]-6-methylpyridine-3-carboxamide;formaldehyde?
The InChIKey is JBWVHZHQAOCEKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FN3O.CH2O/c1-9-6-7-11(13(16)18-9)14(19)17-8-10-4-2-3-5-12(10)15;1-2/h2-7H,8H2,1H3,(H2,16,18)(H,17,19);1H2.
What are the key properties of 2-amino-N-[(2-fluorophenyl)methyl]-6-methylpyridine-3-carboxamide;formaldehyde?
2-amino-N-[(2-fluorophenyl)methyl]-6-methylpyridine-3-carboxamide;formaldehyde has a molecular weight of 289.31 g/mol, XLogP of 1.86, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[(2-fluorophenyl)methyl]-6-methylpyridine-3-carboxamide;formaldehyde is sourced from PubChem (CID 158871409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).