C18H28O4 — CID 5314518
(8R)-2-methoxy-8-(2-methoxyethyl)-8a-methyl-5,8-dihydro-4aH-naphthalene-1,4-dione;propane (PubChem CID 5314518) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is (8R)-2-methoxy-8-(2-methoxyethyl)-8a-methyl-5,8-dihydro-4aH-naphthalene-1,4-dione;propane.
| Compound Name | (8R)-2-methoxy-8-(2-methoxyethyl)-8a-methyl-5,8-dihydro-4aH-naphthalene-1,4-dione;propane |
|---|---|
| PubChem CID | 5314518 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (8R)-2-methoxy-8-(2-methoxyethyl)-8a-methyl-5,8-dihydro-4aH-naphthalene-1,4-dione;propane |
| SMILES | CCC.COCC[C@@H]1C=CCC2C(=O)C=C(OC)C(=O)C21C |
| InChI | InChI=1S/C15H20O4.C3H8/c1-15-10(7-8-18-2)5-4-6-11(15)12(16)9-13(19-3)14(15)17;1-3-2/h4-5,9-11H,6-8H2,1-3H3;3H2,1-2H3/t10-,11?,15?;/m0./s1 |
| InChIKey | MAPPSZIRIJRUMO-FTCMLMHSSA-N |
| XLogP | 3.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|