C18H24N2O2 — CID 53147662
N-cycloheptyl-2-methyl-3-oxo-1,4-dihydroisoquinoline-1-carboxamide (PubChem CID 53147662) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-cycloheptyl-2-methyl-3-oxo-1,4-dihydroisoquinoline-1-carboxamide.
| Compound Name | N-cycloheptyl-2-methyl-3-oxo-1,4-dihydroisoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 53147662 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-cycloheptyl-2-methyl-3-oxo-1,4-dihydroisoquinoline-1-carboxamide |
| SMILES | CN1C(=O)Cc2ccccc2C1C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C18H24N2O2/c1-20-16(21)12-13-8-6-7-11-15(13)17(20)18(22)19-14-9-4-2-3-5-10-14/h6-8,11,14,17H,2-5,9-10,12H2,1H3,(H,19,22) |
| InChIKey | FNWRAMXLJMYNGM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |