C18H16N4O3 — CID 53149802
N-(2,4-dimethoxyphenyl)-6-pyrimidin-5-ylpyridine-3-carboxamide (PubChem CID 53149802) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-6-pyrimidin-5-ylpyridine-3-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-6-pyrimidin-5-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 53149802 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-6-pyrimidin-5-ylpyridine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-c3cncnc3)nc2)c(OC)c1 |
| InChI | InChI=1S/C18H16N4O3/c1-24-14-4-6-16(17(7-14)25-2)22-18(23)12-3-5-15(21-10-12)13-8-19-11-20-9-13/h3-11H,1-2H3,(H,22,23) |
| InChIKey | DZMHDBHXAVEIRJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |