C20H30FNO2 — CID 53150603
1-[4-[2-[(4-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 53150603) has the molecular formula C20H30FNO2 and a molecular weight of 335.46 g/mol. Its IUPAC name is 1-[4-[2-[(4-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[4-[2-[(4-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 53150603 |
| Molecular Formula | C20H30FNO2 |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 1-[4-[2-[(4-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCC(CCOCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H30FNO2/c1-20(2,3)14-19(23)22-11-8-16(9-12-22)10-13-24-15-17-4-6-18(21)7-5-17/h4-7,16H,8-15H2,1-3H3 |
| InChIKey | MHAXHMFMKDSTPT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|