C17H24FNO3 — CID 53150642
1-[4-[2-[(3-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-2-methoxyethanone (PubChem CID 53150642) has the molecular formula C17H24FNO3 and a molecular weight of 309.38 g/mol. Its IUPAC name is 1-[4-[2-[(3-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[4-[2-[(3-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 53150642 |
| Molecular Formula | C17H24FNO3 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-[4-[2-[(3-fluorophenyl)methoxy]ethyl]piperidin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC(CCOCc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H24FNO3/c1-21-13-17(20)19-8-5-14(6-9-19)7-10-22-12-15-3-2-4-16(18)11-15/h2-4,11,14H,5-10,12-13H2,1H3 |
| InChIKey | RHTXZKLSIYGMRT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|