C17H25N3O3 — CID 53151061
N-[2-[4-(2-methoxyethyl)piperidin-1-yl]-2-oxoethyl]-N-methylpyridine-3-carboxamide (PubChem CID 53151061) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is N-[2-[4-(2-methoxyethyl)piperidin-1-yl]-2-oxoethyl]-N-methylpyridine-3-carboxamide.
| Compound Name | N-[2-[4-(2-methoxyethyl)piperidin-1-yl]-2-oxoethyl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 53151061 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-[2-[4-(2-methoxyethyl)piperidin-1-yl]-2-oxoethyl]-N-methylpyridine-3-carboxamide |
| SMILES | COCCC1CCN(C(=O)CN(C)C(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C17H25N3O3/c1-19(17(22)15-4-3-8-18-12-15)13-16(21)20-9-5-14(6-10-20)7-11-23-2/h3-4,8,12,14H,5-7,9-11,13H2,1-2H3 |
| InChIKey | QHQGWRSNSXELIA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |