C19H22N4O3S — CID 53158007
6-(azepan-1-ylsulfonyl)-2-benzyl-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 53158007) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 6-(azepan-1-ylsulfonyl)-2-benzyl-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 6-(azepan-1-ylsulfonyl)-2-benzyl-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 53158007 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 6-(azepan-1-ylsulfonyl)-2-benzyl-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | O=c1n(Cc2ccccc2)nc2ccc(S(=O)(=O)N3CCCCCC3)cn12 |
| InChI | InChI=1S/C19H22N4O3S/c24-19-22-15-17(27(25,26)21-12-6-1-2-7-13-21)10-11-18(22)20-23(19)14-16-8-4-3-5-9-16/h3-5,8-11,15H,1-2,6-7,12-14H2 |
| InChIKey | LXRGUMRJOXYGOA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 76.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |