C24H28N4O3 — CID 53160076
1-N-(4-methylphenyl)-4-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2,3-dihydroindole-1,4-dicarboxamide (PubChem CID 53160076) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 1-N-(4-methylphenyl)-4-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2,3-dihydroindole-1,4-dicarboxamide.
| Compound Name | 1-N-(4-methylphenyl)-4-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2,3-dihydroindole-1,4-dicarboxamide |
|---|---|
| PubChem CID | 53160076 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-N-(4-methylphenyl)-4-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2,3-dihydroindole-1,4-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCc3c(C(=O)NCCCN4CCCC4=O)cccc32)cc1 |
| InChI | InChI=1S/C24H28N4O3/c1-17-8-10-18(11-9-17)26-24(31)28-16-12-19-20(5-2-6-21(19)28)23(30)25-13-4-15-27-14-3-7-22(27)29/h2,5-6,8-11H,3-4,7,12-16H2,1H3,(H,25,30)(H,26,31) |
| InChIKey | WURCOMICYMVJKK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|