C20H23N3O2 — CID 53160123
4-N-butyl-1-N-phenyl-2,3-dihydroindole-1,4-dicarboxamide (PubChem CID 53160123) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 4-N-butyl-1-N-phenyl-2,3-dihydroindole-1,4-dicarboxamide.
| Compound Name | 4-N-butyl-1-N-phenyl-2,3-dihydroindole-1,4-dicarboxamide |
|---|---|
| PubChem CID | 53160123 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 4-N-butyl-1-N-phenyl-2,3-dihydroindole-1,4-dicarboxamide |
| SMILES | CCCCNC(=O)c1cccc2c1CCN2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H23N3O2/c1-2-3-13-21-19(24)17-10-7-11-18-16(17)12-14-23(18)20(25)22-15-8-5-4-6-9-15/h4-11H,2-3,12-14H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | RMELJYPIZKDCRP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|