C22H21N3O2S — CID 53160126
1-N-phenyl-4-N-(2-thiophen-2-ylethyl)-2,3-dihydroindole-1,4-dicarboxamide (PubChem CID 53160126) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 1-N-phenyl-4-N-(2-thiophen-2-ylethyl)-2,3-dihydroindole-1,4-dicarboxamide.
| Compound Name | 1-N-phenyl-4-N-(2-thiophen-2-ylethyl)-2,3-dihydroindole-1,4-dicarboxamide |
|---|---|
| PubChem CID | 53160126 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 1-N-phenyl-4-N-(2-thiophen-2-ylethyl)-2,3-dihydroindole-1,4-dicarboxamide |
| SMILES | O=C(NCCc1cccs1)c1cccc2c1CCN2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H21N3O2S/c26-21(23-13-11-17-8-5-15-28-17)19-9-4-10-20-18(19)12-14-25(20)22(27)24-16-6-2-1-3-7-16/h1-10,15H,11-14H2,(H,23,26)(H,24,27) |
| InChIKey | UJYYCBANAJOCHO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |