C12H15N5O3S2 — CID 53163272
N-[(2,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 53163272) has the molecular formula C12H15N5O3S2 and a molecular weight of 341.42 g/mol. Its IUPAC name is N-[(2,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[(2,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 53163272 |
| Molecular Formula | C12H15N5O3S2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | N-[(2,6-dimethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1nn2c(CNS(=O)(=O)c3c(C)noc3C)c(C)nc2s1 |
| InChI | InChI=1S/C12H15N5O3S2/c1-6-10(17-12(14-6)21-9(4)15-17)5-13-22(18,19)11-7(2)16-20-8(11)3/h13H,5H2,1-4H3 |
| InChIKey | CSMIEELPTMXHOL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |