C20H26N2O2S — CID 53167250
N-[2-(cyclohexen-1-yl)ethyl]-2-methyl-4-oxo-5-propylthieno[3,2-c]pyridine-3-carboxamide (PubChem CID 53167250) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-methyl-4-oxo-5-propylthieno[3,2-c]pyridine-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-methyl-4-oxo-5-propylthieno[3,2-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 53167250 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-methyl-4-oxo-5-propylthieno[3,2-c]pyridine-3-carboxamide |
| SMILES | CCCn1ccc2sc(C)c(C(=O)NCCC3=CCCCC3)c2c1=O |
| InChI | InChI=1S/C20H26N2O2S/c1-3-12-22-13-10-16-18(20(22)24)17(14(2)25-16)19(23)21-11-9-15-7-5-4-6-8-15/h7,10,13H,3-6,8-9,11-12H2,1-2H3,(H,21,23) |
| InChIKey | GNOOZJKICLZQQE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|