C18H20ClN3O5S — CID 53170666
N-[(4-chlorophenyl)methyl]-2-(5-morpholin-4-ylsulfonyl-2-oxo-1-pyridinyl)acetamide (PubChem CID 53170666) has the molecular formula C18H20ClN3O5S and a molecular weight of 425.89 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(5-morpholin-4-ylsulfonyl-2-oxo-1-pyridinyl)acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(5-morpholin-4-ylsulfonyl-2-oxo-1-pyridinyl)acetamide |
|---|---|
| PubChem CID | 53170666 |
| Molecular Formula | C18H20ClN3O5S |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(5-morpholin-4-ylsulfonyl-2-oxo-1-pyridinyl)acetamide |
| SMILES | O=C(Cn1cc(S(=O)(=O)N2CCOCC2)ccc1=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClN3O5S/c19-15-3-1-14(2-4-15)11-20-17(23)13-21-12-16(5-6-18(21)24)28(25,26)22-7-9-27-10-8-22/h1-6,12H,7-11,13H2,(H,20,23) |
| InChIKey | FGNJUNFYXCLGJK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |