C23H19N5O3S — CID 53172407
N-[(4-methoxyphenyl)methyl]-2-(7-oxo-4-thiophen-2-yl-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetamide (PubChem CID 53172407) has the molecular formula C23H19N5O3S and a molecular weight of 445.50 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-(7-oxo-4-thiophen-2-yl-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-(7-oxo-4-thiophen-2-yl-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetamide |
|---|---|
| PubChem CID | 53172407 |
| Molecular Formula | C23H19N5O3S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-(7-oxo-4-thiophen-2-yl-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetamide |
| SMILES | COc1ccc(CNC(=O)Cn2c(=O)c3cc(-c4cccs4)nn3c3ncccc32)cc1 |
| InChI | InChI=1S/C23H19N5O3S/c1-31-16-8-6-15(7-9-16)13-25-21(29)14-27-18-4-2-10-24-22(18)28-19(23(27)30)12-17(26-28)20-5-3-11-32-20/h2-12H,13-14H2,1H3,(H,25,29) |
| InChIKey | JUZLQSOZFGGVGV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |