C20H15N5O3S — CID 53172422
2-[4-(furan-2-yl)-7-oxo-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 53172422) has the molecular formula C20H15N5O3S and a molecular weight of 405.44 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)-7-oxo-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[4-(furan-2-yl)-7-oxo-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 53172422 |
| Molecular Formula | C20H15N5O3S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-[4-(furan-2-yl)-7-oxo-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1c(=O)c2cc(-c3ccco3)nn2c2ncccc21)NCc1cccs1 |
| InChI | InChI=1S/C20H15N5O3S/c26-18(22-11-13-4-3-9-29-13)12-24-15-5-1-7-21-19(15)25-16(20(24)27)10-14(23-25)17-6-2-8-28-17/h1-10H,11-12H2,(H,22,26) |
| InChIKey | QVAIBBJMROSASW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |