C19H16ClN5O2 — CID 53172386
N-[(2-chlorophenyl)methyl]-2-(4-methyl-7-oxo-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetamide (PubChem CID 53172386) has the molecular formula C19H16ClN5O2 and a molecular weight of 381.82 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(4-methyl-7-oxo-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(4-methyl-7-oxo-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetamide |
|---|---|
| PubChem CID | 53172386 |
| Molecular Formula | C19H16ClN5O2 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(4-methyl-7-oxo-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetamide |
| SMILES | Cc1cc2c(=O)n(CC(=O)NCc3ccccc3Cl)c3cccnc3n2n1 |
| InChI | InChI=1S/C19H16ClN5O2/c1-12-9-16-19(27)24(15-7-4-8-21-18(15)25(16)23-12)11-17(26)22-10-13-5-2-3-6-14(13)20/h2-9H,10-11H2,1H3,(H,22,26) |
| InChIKey | YXSJLPYMIVCHSM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |