C20H17N5O4 — CID 53172320
methyl 4-[[2-(4-methyl-7-oxo-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetyl]amino]benzoate (PubChem CID 53172320) has the molecular formula C20H17N5O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is methyl 4-[[2-(4-methyl-7-oxo-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(4-methyl-7-oxo-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 53172320 |
| Molecular Formula | C20H17N5O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | methyl 4-[[2-(4-methyl-7-oxo-2,3,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)Cn2c(=O)c3cc(C)nn3c3ncccc32)cc1 |
| InChI | InChI=1S/C20H17N5O4/c1-12-10-16-19(27)24(15-4-3-9-21-18(15)25(16)23-12)11-17(26)22-14-7-5-13(6-8-14)20(28)29-2/h3-10H,11H2,1-2H3,(H,22,26) |
| InChIKey | KNHITFCKPKLNBL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |