C16H12O7 — CID 5317284
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one (PubChem CID 5317284) has the molecular formula C16H12O7 and a molecular weight of 316.27 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one |
|---|---|
| PubChem CID | 5317284 |
| Molecular Formula | C16H12O7 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-methoxychromen-4-one |
| SMILES | COc1c(O)cc2oc(-c3ccc(O)c(O)c3)cc(=O)c2c1O |
| InChI | InChI=1S/C16H12O7/c1-22-16-11(20)6-13-14(15(16)21)10(19)5-12(23-13)7-2-3-8(17)9(18)4-7/h2-6,17-18,20-21H,1H3 |
| InChIKey | FHHSEFRSDKWJKJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|