C22H29N5O2 — CID 53175260
N-[2-(cyclohexen-1-yl)ethyl]-3-[2-(4-methylpiperidin-1-yl)-4-pyridinyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 53175260) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-[2-(4-methylpiperidin-1-yl)-4-pyridinyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[2-(4-methylpiperidin-1-yl)-4-pyridinyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 53175260 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[2-(4-methylpiperidin-1-yl)-4-pyridinyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CC1CCN(c2cc(-c3noc(C(=O)NCCC4=CCCCC4)n3)ccn2)CC1 |
| InChI | InChI=1S/C22H29N5O2/c1-16-9-13-27(14-10-16)19-15-18(8-12-23-19)20-25-22(29-26-20)21(28)24-11-7-17-5-3-2-4-6-17/h5,8,12,15-16H,2-4,6-7,9-11,13-14H2,1H3,(H,24,28) |
| InChIKey | XAVKFQCHEFZSJN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|