C13H11N3O4S — CID 53175453
5-(5-methyl-1,3,4-oxadiazol-2-yl)-N-phenylfuran-2-sulfonamide (PubChem CID 53175453) has the molecular formula C13H11N3O4S and a molecular weight of 305.32 g/mol. Its IUPAC name is 5-(5-methyl-1,3,4-oxadiazol-2-yl)-N-phenylfuran-2-sulfonamide.
| Compound Name | 5-(5-methyl-1,3,4-oxadiazol-2-yl)-N-phenylfuran-2-sulfonamide |
|---|---|
| PubChem CID | 53175453 |
| Molecular Formula | C13H11N3O4S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 5-(5-methyl-1,3,4-oxadiazol-2-yl)-N-phenylfuran-2-sulfonamide |
| SMILES | Cc1nnc(-c2ccc(S(=O)(=O)Nc3ccccc3)o2)o1 |
| InChI | InChI=1S/C13H11N3O4S/c1-9-14-15-13(19-9)11-7-8-12(20-11)21(17,18)16-10-5-3-2-4-6-10/h2-8,16H,1H3 |
| InChIKey | IGXYZQUXTRWQRB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |