C15H21N3O4S — CID 53175464
N-cycloheptyl-5-(5-ethyl-1,3,4-oxadiazol-2-yl)furan-2-sulfonamide (PubChem CID 53175464) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is N-cycloheptyl-5-(5-ethyl-1,3,4-oxadiazol-2-yl)furan-2-sulfonamide.
| Compound Name | N-cycloheptyl-5-(5-ethyl-1,3,4-oxadiazol-2-yl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 53175464 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-cycloheptyl-5-(5-ethyl-1,3,4-oxadiazol-2-yl)furan-2-sulfonamide |
| SMILES | CCc1nnc(-c2ccc(S(=O)(=O)NC3CCCCCC3)o2)o1 |
| InChI | InChI=1S/C15H21N3O4S/c1-2-13-16-17-15(22-13)12-9-10-14(21-12)23(19,20)18-11-7-5-3-4-6-8-11/h9-11,18H,2-8H2,1H3 |
| InChIKey | LWNSUPMSUYMERN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |