C18H20N4O5S — CID 53175752
2-[5-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylfuran-3-yl]-5-methyl-1,3,4-oxadiazole (PubChem CID 53175752) has the molecular formula C18H20N4O5S and a molecular weight of 404.45 g/mol. Its IUPAC name is 2-[5-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylfuran-3-yl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-[5-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylfuran-3-yl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 53175752 |
| Molecular Formula | C18H20N4O5S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-[5-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonylfuran-3-yl]-5-methyl-1,3,4-oxadiazole |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3cc(-c4nnc(C)o4)co3)CC2)cc1 |
| InChI | InChI=1S/C18H20N4O5S/c1-13-19-20-18(27-13)14-11-17(26-12-14)28(23,24)22-9-7-21(8-10-22)15-3-5-16(25-2)6-4-15/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | HKTWZZBQUXLUNS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 101.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|