C17H16FN5O3 — CID 53181108
9-[1-[2-(4-fluorophenoxy)acetyl]pyrrolidin-3-yl]-7H-purin-8-one (PubChem CID 53181108) has the molecular formula C17H16FN5O3 and a molecular weight of 357.35 g/mol. Its IUPAC name is 9-[1-[2-(4-fluorophenoxy)acetyl]pyrrolidin-3-yl]-7H-purin-8-one.
| Compound Name | 9-[1-[2-(4-fluorophenoxy)acetyl]pyrrolidin-3-yl]-7H-purin-8-one |
|---|---|
| PubChem CID | 53181108 |
| Molecular Formula | C17H16FN5O3 |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 9-[1-[2-(4-fluorophenoxy)acetyl]pyrrolidin-3-yl]-7H-purin-8-one |
| SMILES | O=C(COc1ccc(F)cc1)N1CCC(n2c(=O)[nH]c3cncnc32)C1 |
| InChI | InChI=1S/C17H16FN5O3/c18-11-1-3-13(4-2-11)26-9-15(24)22-6-5-12(8-22)23-16-14(21-17(23)25)7-19-10-20-16/h1-4,7,10,12H,5-6,8-9H2,(H,21,25) |
| InChIKey | DGOXCORPWPPPGH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |