C20H15N3O2S — CID 53182583
N-(6-methyl-5-oxopyrido[2,3-b][1,5]benzothiazepin-9-yl)benzamide (PubChem CID 53182583) has the molecular formula C20H15N3O2S and a molecular weight of 361.43 g/mol. Its IUPAC name is N-(6-methyl-5-oxopyrido[2,3-b][1,5]benzothiazepin-9-yl)benzamide.
| Compound Name | N-(6-methyl-5-oxopyrido[2,3-b][1,5]benzothiazepin-9-yl)benzamide |
|---|---|
| PubChem CID | 53182583 |
| Molecular Formula | C20H15N3O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-(6-methyl-5-oxopyrido[2,3-b][1,5]benzothiazepin-9-yl)benzamide |
| SMILES | CN1C(=O)c2cccnc2Sc2cc(NC(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C20H15N3O2S/c1-23-16-10-9-14(22-18(24)13-6-3-2-4-7-13)12-17(16)26-19-15(20(23)25)8-5-11-21-19/h2-12H,1H3,(H,22,24) |
| InChIKey | WDGKZBAYDGHXMN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |