C22H15N3O2S — CID 46365573
4-cyano-N-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-2-yl)benzamide (PubChem CID 46365573) has the molecular formula C22H15N3O2S and a molecular weight of 385.45 g/mol. Its IUPAC name is 4-cyano-N-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-2-yl)benzamide.
| Compound Name | 4-cyano-N-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-2-yl)benzamide |
|---|---|
| PubChem CID | 46365573 |
| Molecular Formula | C22H15N3O2S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 4-cyano-N-(5-methyl-6-oxobenzo[b][1,4]benzothiazepin-2-yl)benzamide |
| SMILES | CN1C(=O)c2ccccc2Sc2cc(NC(=O)c3ccc(C#N)cc3)ccc21 |
| InChI | InChI=1S/C22H15N3O2S/c1-25-18-11-10-16(24-21(26)15-8-6-14(13-23)7-9-15)12-20(18)28-19-5-3-2-4-17(19)22(25)27/h2-12H,1H3,(H,24,26) |
| InChIKey | JQVNZJBHTZXQIP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |