C19H19N5O — CID 53185286
[3-(3-phenyl-1H-pyrazol-5-yl)piperidin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 53185286) has the molecular formula C19H19N5O and a molecular weight of 333.39 g/mol. Its IUPAC name is [3-(3-phenyl-1H-pyrazol-5-yl)piperidin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [3-(3-phenyl-1H-pyrazol-5-yl)piperidin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 53185286 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [3-(3-phenyl-1H-pyrazol-5-yl)piperidin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CCCC(c2cc(-c3ccccc3)n[nH]2)C1 |
| InChI | InChI=1S/C19H19N5O/c25-19(18-12-20-8-9-21-18)24-10-4-7-15(13-24)17-11-16(22-23-17)14-5-2-1-3-6-14/h1-3,5-6,8-9,11-12,15H,4,7,10,13H2,(H,22,23) |
| InChIKey | MRWDXGGZYWRRBJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |