C22H22N4O2 — CID 95809539
[(3S)-3-[6-(3-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 95809539) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is [(3S)-3-[6-(3-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(3S)-3-[6-(3-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 95809539 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | [(3S)-3-[6-(3-methoxyphenyl)-2-pyridinyl]piperidin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | COc1cccc(-c2cccc([C@H]3CCCN(C(=O)c4cnccn4)C3)n2)c1 |
| InChI | InChI=1S/C22H22N4O2/c1-28-18-7-2-5-16(13-18)19-8-3-9-20(25-19)17-6-4-12-26(15-17)22(27)21-14-23-10-11-24-21/h2-3,5,7-11,13-14,17H,4,6,12,15H2,1H3/t17-/m0/s1 |
| InChIKey | RRVDRBKUHACZCN-KRWDZBQOSA-N |
| XLogP | 3.57 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |