C23H24N4O2 — CID 95809563
[(3R)-3-[6-[(3-methoxyphenyl)methyl]-2-pyridinyl]piperidin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 95809563) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is [(3R)-3-[6-[(3-methoxyphenyl)methyl]-2-pyridinyl]piperidin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(3R)-3-[6-[(3-methoxyphenyl)methyl]-2-pyridinyl]piperidin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 95809563 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [(3R)-3-[6-[(3-methoxyphenyl)methyl]-2-pyridinyl]piperidin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | COc1cccc(Cc2cccc([C@@H]3CCCN(C(=O)c4cnccn4)C3)n2)c1 |
| InChI | InChI=1S/C23H24N4O2/c1-29-20-8-2-5-17(14-20)13-19-7-3-9-21(26-19)18-6-4-12-27(16-18)23(28)22-15-24-10-11-25-22/h2-3,5,7-11,14-15,18H,4,6,12-13,16H2,1H3/t18-/m1/s1 |
| InChIKey | RAZRGZVUIGRESE-GOSISDBHSA-N |
| XLogP | 3.49 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |