C16H20N6O2 — CID 53185700
N-[1-(3-ethoxypyrazin-2-yl)pyrrolidin-3-yl]-N-methylpyrazine-2-carboxamide (PubChem CID 53185700) has the molecular formula C16H20N6O2 and a molecular weight of 328.38 g/mol. Its IUPAC name is N-[1-(3-ethoxypyrazin-2-yl)pyrrolidin-3-yl]-N-methylpyrazine-2-carboxamide.
| Compound Name | N-[1-(3-ethoxypyrazin-2-yl)pyrrolidin-3-yl]-N-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 53185700 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-[1-(3-ethoxypyrazin-2-yl)pyrrolidin-3-yl]-N-methylpyrazine-2-carboxamide |
| SMILES | CCOc1nccnc1N1CCC(N(C)C(=O)c2cnccn2)C1 |
| InChI | InChI=1S/C16H20N6O2/c1-3-24-15-14(19-7-8-20-15)22-9-4-12(11-22)21(2)16(23)13-10-17-5-6-18-13/h5-8,10,12H,3-4,9,11H2,1-2H3 |
| InChIKey | BDLNUYYFWSZCGF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 84.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |