C14H16N6O2 — CID 53185604
N-[1-(3-methoxypyrazin-2-yl)pyrrolidin-3-yl]pyrazine-2-carboxamide (PubChem CID 53185604) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is N-[1-(3-methoxypyrazin-2-yl)pyrrolidin-3-yl]pyrazine-2-carboxamide.
| Compound Name | N-[1-(3-methoxypyrazin-2-yl)pyrrolidin-3-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 53185604 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[1-(3-methoxypyrazin-2-yl)pyrrolidin-3-yl]pyrazine-2-carboxamide |
| SMILES | COc1nccnc1N1CCC(NC(=O)c2cnccn2)C1 |
| InChI | InChI=1S/C14H16N6O2/c1-22-14-12(17-5-6-18-14)20-7-2-10(9-20)19-13(21)11-8-15-3-4-16-11/h3-6,8,10H,2,7,9H2,1H3,(H,19,21) |
| InChIKey | PAUDBHUWSYAQQB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |