C15H18N6O2 — CID 53185722
N-[1-(3-methoxypyrazin-2-yl)pyrrolidin-3-yl]-N-methylpyrazine-2-carboxamide (PubChem CID 53185722) has the molecular formula C15H18N6O2 and a molecular weight of 314.35 g/mol. Its IUPAC name is N-[1-(3-methoxypyrazin-2-yl)pyrrolidin-3-yl]-N-methylpyrazine-2-carboxamide.
| Compound Name | N-[1-(3-methoxypyrazin-2-yl)pyrrolidin-3-yl]-N-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 53185722 |
| Molecular Formula | C15H18N6O2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-[1-(3-methoxypyrazin-2-yl)pyrrolidin-3-yl]-N-methylpyrazine-2-carboxamide |
| SMILES | COc1nccnc1N1CCC(N(C)C(=O)c2cnccn2)C1 |
| InChI | InChI=1S/C15H18N6O2/c1-20(15(22)12-9-16-4-5-17-12)11-3-8-21(10-11)13-14(23-2)19-7-6-18-13/h4-7,9,11H,3,8,10H2,1-2H3 |
| InChIKey | HADWZLSPAQAPLU-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 84.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |