C24H24N4O4 — CID 53187542
N-[6-(3-benzyl-2-oxoimidazolidin-1-yl)-3-pyridinyl]-2,3-dimethoxybenzamide (PubChem CID 53187542) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is N-[6-(3-benzyl-2-oxoimidazolidin-1-yl)-3-pyridinyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[6-(3-benzyl-2-oxoimidazolidin-1-yl)-3-pyridinyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 53187542 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-[6-(3-benzyl-2-oxoimidazolidin-1-yl)-3-pyridinyl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(N3CCN(Cc4ccccc4)C3=O)nc2)c1OC |
| InChI | InChI=1S/C24H24N4O4/c1-31-20-10-6-9-19(22(20)32-2)23(29)26-18-11-12-21(25-15-18)28-14-13-27(24(28)30)16-17-7-4-3-5-8-17/h3-12,15H,13-14,16H2,1-2H3,(H,26,29) |
| InChIKey | YATXOXNOUITZPW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |