C20H33N3O4S2 — CID 53194241
1-(3-ethyl-1-methylsulfonylpyrrolidin-3-yl)-4-(4-propylphenyl)sulfonylpiperazine (PubChem CID 53194241) has the molecular formula C20H33N3O4S2 and a molecular weight of 443.64 g/mol. Its IUPAC name is 1-(3-ethyl-1-methylsulfonylpyrrolidin-3-yl)-4-(4-propylphenyl)sulfonylpiperazine.
| Compound Name | 1-(3-ethyl-1-methylsulfonylpyrrolidin-3-yl)-4-(4-propylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 53194241 |
| Molecular Formula | C20H33N3O4S2 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 1-(3-ethyl-1-methylsulfonylpyrrolidin-3-yl)-4-(4-propylphenyl)sulfonylpiperazine |
| SMILES | CCCc1ccc(S(=O)(=O)N2CCN(C3(CC)CCN(S(C)(=O)=O)C3)CC2)cc1 |
| InChI | InChI=1S/C20H33N3O4S2/c1-4-6-18-7-9-19(10-8-18)29(26,27)22-15-13-21(14-16-22)20(5-2)11-12-23(17-20)28(3,24)25/h7-10H,4-6,11-17H2,1-3H3 |
| InChIKey | HBZWDIPJNZCPFK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |