C19H31N3O5S2 — CID 53194239
1-(4-ethoxyphenyl)sulfonyl-4-(3-ethyl-1-methylsulfonylpyrrolidin-3-yl)piperazine (PubChem CID 53194239) has the molecular formula C19H31N3O5S2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)sulfonyl-4-(3-ethyl-1-methylsulfonylpyrrolidin-3-yl)piperazine.
| Compound Name | 1-(4-ethoxyphenyl)sulfonyl-4-(3-ethyl-1-methylsulfonylpyrrolidin-3-yl)piperazine |
|---|---|
| PubChem CID | 53194239 |
| Molecular Formula | C19H31N3O5S2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-(4-ethoxyphenyl)sulfonyl-4-(3-ethyl-1-methylsulfonylpyrrolidin-3-yl)piperazine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C3(CC)CCN(S(C)(=O)=O)C3)CC2)cc1 |
| InChI | InChI=1S/C19H31N3O5S2/c1-4-19(10-11-22(16-19)28(3,23)24)20-12-14-21(15-13-20)29(25,26)18-8-6-17(7-9-18)27-5-2/h6-9H,4-5,10-16H2,1-3H3 |
| InChIKey | WRLMOSNLIQLOGK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |