C20H21N3O — CID 53197836
N-[5-methyl-4-(3-methylphenyl)-1H-pyrazol-3-yl]-2-(3-methylphenyl)acetamide (PubChem CID 53197836) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[5-methyl-4-(3-methylphenyl)-1H-pyrazol-3-yl]-2-(3-methylphenyl)acetamide.
| Compound Name | N-[5-methyl-4-(3-methylphenyl)-1H-pyrazol-3-yl]-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 53197836 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-[5-methyl-4-(3-methylphenyl)-1H-pyrazol-3-yl]-2-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(CC(=O)Nc2n[nH]c(C)c2-c2cccc(C)c2)c1 |
| InChI | InChI=1S/C20H21N3O/c1-13-6-4-8-16(10-13)12-18(24)21-20-19(15(3)22-23-20)17-9-5-7-14(2)11-17/h4-11H,12H2,1-3H3,(H2,21,22,23,24) |
| InChIKey | RSKONEBZUKDEHE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |