C14H16N2O2 — CID 82478389
3-[5-methyl-4-(3-methylphenyl)-1H-pyrazol-3-yl]propanoic acid (PubChem CID 82478389) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-[5-methyl-4-(3-methylphenyl)-1H-pyrazol-3-yl]propanoic acid.
| Compound Name | 3-[5-methyl-4-(3-methylphenyl)-1H-pyrazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 82478389 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-[5-methyl-4-(3-methylphenyl)-1H-pyrazol-3-yl]propanoic acid |
| SMILES | Cc1cccc(-c2c(CCC(=O)O)n[nH]c2C)c1 |
| InChI | InChI=1S/C14H16N2O2/c1-9-4-3-5-11(8-9)14-10(2)15-16-12(14)6-7-13(17)18/h3-5,8H,6-7H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | PBWGINHYMHPTHO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |