C18H17NO2 — CID 142738544
3-[2-(3-methylphenyl)-1H-indol-5-yl]propanoic acid (PubChem CID 142738544) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-[2-(3-methylphenyl)-1H-indol-5-yl]propanoic acid.
| Compound Name | 3-[2-(3-methylphenyl)-1H-indol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 142738544 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-[2-(3-methylphenyl)-1H-indol-5-yl]propanoic acid |
| SMILES | Cc1cccc(-c2cc3cc(CCC(=O)O)ccc3[nH]2)c1 |
| InChI | InChI=1S/C18H17NO2/c1-12-3-2-4-14(9-12)17-11-15-10-13(6-8-18(20)21)5-7-16(15)19-17/h2-5,7,9-11,19H,6,8H2,1H3,(H,20,21) |
| InChIKey | PVQBQICKPMWELZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |