C20H18F3NO2 — CID 142738596
ethyl 3-[2-[2-(trifluoromethyl)phenyl]-1H-indol-5-yl]propanoate (PubChem CID 142738596) has the molecular formula C20H18F3NO2 and a molecular weight of 361.36 g/mol. Its IUPAC name is ethyl 3-[2-[2-(trifluoromethyl)phenyl]-1H-indol-5-yl]propanoate.
| Compound Name | ethyl 3-[2-[2-(trifluoromethyl)phenyl]-1H-indol-5-yl]propanoate |
|---|---|
| PubChem CID | 142738596 |
| Molecular Formula | C20H18F3NO2 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | ethyl 3-[2-[2-(trifluoromethyl)phenyl]-1H-indol-5-yl]propanoate |
| SMILES | CCOC(=O)CCc1ccc2[nH]c(-c3ccccc3C(F)(F)F)cc2c1 |
| InChI | InChI=1S/C20H18F3NO2/c1-2-26-19(25)10-8-13-7-9-17-14(11-13)12-18(24-17)15-5-3-4-6-16(15)20(21,22)23/h3-7,9,11-12,24H,2,8,10H2,1H3 |
| InChIKey | YYEFGJMHHCDYTC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |