C44H54N4O16 — CID 532
3-[8,13,17-tris(2-carboxyethyl)-2,7,12,18-tetrakis(carboxymethyl)-1,2,7,11,17-pentamethyl-3,10,21,24-tetrahydrocorrin-3-yl]propanoic acid (PubChem CID 532) has the molecular formula C44H54N4O16 and a molecular weight of 894.93 g/mol. Its IUPAC name is 3-[8,13,17-tris(2-carboxyethyl)-2,7,12,18-tetrakis(carboxymethyl)-1,2,7,11,17-pentamethyl-3,10,21,24-tetrahydrocorrin-3-yl]propanoic acid.
| Compound Name | 3-[8,13,17-tris(2-carboxyethyl)-2,7,12,18-tetrakis(carboxymethyl)-1,2,7,11,17-pentamethyl-3,10,21,24-tetrahydrocorrin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 532 |
| Molecular Formula | C44H54N4O16 |
| Molecular Weight | 894.93 g/mol |
| Exact Mass | 894.35 |
| IUPAC Name | 3-[8,13,17-tris(2-carboxyethyl)-2,7,12,18-tetrakis(carboxymethyl)-1,2,7,11,17-pentamethyl-3,10,21,24-tetrahydrocorrin-3-yl]propanoic acid |
| SMILES | CC12CC3=C(CCC(=O)O)C(C)(CC(=O)O)C(=N3)C=C3NC(C)(C4=C(CC(=O)O)C(C)(CCC(=O)O)C(=CC(=N1)C(CCC(=O)O)=C2CC(=O)O)N4)C(C)(CC(=O)O)C3CCC(=O)O |
| InChI | InChI=1S/C44H54N4O16/c1-40(13-12-34(55)56)25(15-36(59)60)39-44(5)42(3,20-38(63)64)23(8-11-33(53)54)27(48-44)17-30-41(2,19-37(61)62)22(7-10-32(51)52)28(45-30)18-43(4)24(14-35(57)58)21(6-9-31(49)50)26(47-43)16-29(40)46-39/h16-17,23,46,48H,6-15,18-20H2,1-5H3,(H,49,50)(H,51,52)(H,53,54)(H,55,56)(H,57,58)(H,59,60)(H,61,62)(H,63,64) |
| InChIKey | CJGNMYWHRHHNGH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 347.18 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |